Compound Q&A

How is 2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate (CAS: 1415329-20-2) typically synthesized?

Answer

2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate
2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate is typically synthesized via a condensation reaction of a specific alcohol with maleic anhydride in the presence of a catalyst such as p-toluenesulfonic acid. The reaction involves multiple steps, including esterification and ring formation, with a good yield of up to 85%. The reaction is selective and produces a single isomer.

About

English Name 2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate
Molecular Formula C15H28O7
Molecular Weight 320.38 g/mol
SMILES O=CCOCCOCCOCCOCCC(=O)OC(C)(C)C
InChIKey SCAAICMVIUVGGM-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate (CAS: 1415329-20-2)?

2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate is a crystalline solid with a molecula...

Compound Q&A

What industries use 2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate (CAS: 1415329-20-2)?

2-Methyl-2-propanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate is used in various industries, includi...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate (CAS: 1415329-20-2)?

When handling 2-Methyl-2-proanyl 1-oxo-3,6,9,12-tetraoxapentadecan-15-oate, it is important to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...