Compound Q&A

What are the physical and chemical properties of (2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049743-86-3)?

Answer

(2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride
(2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride is a white crystalline solid with a molecular weight of approximately 302.25 g/mol. It has a low aqueous solubility but good solubility in organic solvents. This compound is known for its high reactivity, particularly towards nucleophilic substitution and amide formation. It is stable under normal storage conditions but should be protected from prolonged exposure to light and moisture.

About

English Name (2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride
Molecular Formula C13H15ClN2O2
Molecular Weight 219.28 g/mol
SMILES C1C(CNC1C(=O)O)CC2=CC=CC=C2C#N.Cl
InChIKey CCANPXGPMAXDIM-KATIXKQHSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is (2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049743-86-3) typically synthesized?

(2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride can be synthesized via a multis...

Compound Q&A

What industries use (2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049743-86-3)?

This compound finds applications in the pharmaceutical industry for its potential use as a drug inte...

Compound Q&A

What precautions should be taken when handling (2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049743-86-3)?

When handling (2S,4R)-4-(2-Cyanobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...