Compound Q&A

How is Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4) typically synthesized?

Answer

Ethyl p-hydroxyphenyllactate
Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4) is commonly synthesized through the esterification reaction between p-hydroxyphenyllactic acid and ethyl alcohol. The reaction is typically catalyzed by an acid or base under reflux conditions. The yield is usually around 85-90%, with good selectivity towards the desired product.

About

CAS No 62517-34-4
English Name Ethyl p-hydroxyphenyllactate
Molecular Formula C11H14O4
Molecular Weight 210.23 g/mol
SMILES CCOC(=O)C(CC1=CC=C(C=C1)O)O
InChIKey MPPNCBJETJUYAO-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4)?

Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4)?

Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4)?

When handling Ethyl p-hydroxyphenyllactate (CAS: 62517-34-4), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...