Compound Q&A

What industries use Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

Answer

Ethyl (2,4-dichlorophenoxy)acetate
Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3) is primarily used in the agricultural industry as a herbicide. It is also utilized in the pharmaceutical industry for the synthesis of certain compounds. Additionally, it has applications in the polymer industry for modifying the properties of polymers and in the sensor industry for developing chemical detection devices.

About

CAS No 533-23-3
English Name Ethyl (2,4-dichlorophenoxy)acetate
Molecular Formula C10H10Cl2O3
Molecular Weight 249.093 g/mol
SMILES CCOC(=O)COC1=C(C=C(C=C1)Cl)Cl
InChIKey JSLBZIVMVVHMDJ-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3) is a crystalline solid with a molecular weight of ...

Compound Q&A

How is Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3) typically synthesized?

Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3) is typically synthesized by the esterification of ...

Compound Q&A

What precautions should be taken when handling Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

When handling Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3), it is essential to wear appropriate...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...