Compound Q&A

What are the physical and chemical properties of Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

Answer

Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3) is a crystalline solid with a molecular weight of approximately 271.01 g/mol. It has a low solubility in water but good solubility in organic solvents such as ethanol and acetone. This compound exhibits moderate reactivity, particularly towards nucleophiles and reducing agents. It is also known for its instability under basic conditions.

About

CAS No 533-23-3

English Name Ethyl (2,4-dichlorophenoxy)acetate

Molecular Formula C10H10Cl2O3

Molecular Weight 249.093 g/mol

SMILES CCOC(=O)COC1=C(C=C(C=C1)Cl)Cl

InChIKey JSLBZIVMVVHMDJ-UHFFFAOYSA-N

Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3) typically synthesized?

Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3) is typically synthesized by the esterification of ...

Compound Q&A

What industries use Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3) is primarily used in the agricultural industry as ...

Compound Q&A

What precautions should be taken when handling Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

When handling Ethyl (2,4-dichlorophenoxy)acetate (CAS 533-23-3), it is essential to wear appropriate...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What are the physical and chemical properties of Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

Answer

About

Related Q&A

How is Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3) typically synthesized?

What industries use Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

What precautions should be taken when handling Ethyl (2,4-dichlorophenoxy)acetate (CAS: 533-23-3)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Hubei Shixing Chemical Co., Ltd.

ShangHaiYiHe Biotechnology Co Ltd

Hebei Duling International Trade Co., Ltd.

Shanghai Aladdin Bio-Technologies Co., Ltd.

Beijing Bailingwei Technology Co., Ltd.

JACS- ZhengZhouJieKeSiHuaGongChanPin Co Ltd