Compound Q&A

What industries use tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate (CAS: 890709-17-8)?

Answer

tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate
tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate is primarily used in the pharmaceutical industry for the development of new medicinal compounds. It also finds applications in the sensor industry due to its potential as a ligand. Additionally, it may be involved in the synthesis of materials for semiconductor technologies.

About

English Name tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate
Molecular Formula C18H23N3O2
Molecular Weight 313.4 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)C2=NC3=CC=CC=C3C=C2
InChIKey MOGQKMUFSORICV-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate (CAS: 890709-17-8)?

The physical properties of tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate include a white crys...

Compound Q&A

How is tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate (CAS: 890709-17-8) typically synthesized?

tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate is commonly synthesized through a multistep pro...

Compound Q&A

What precautions should be taken when handling tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate (CAS: 890709-17-8)?

When handling tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate, it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...