Compound Q&A

What are the physical and chemical properties of 3-{1-[(2Z)-4-Amino-2-fluoro-2-buten-1-yl]-2-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl}-N,N-dimethylbenzenesulfonamide dihydrochloride (CAS: 2125956-82-1)?

Answer

3-{1-[(2Z)-4-Amino-2-fluoro-2-buten-1-yl]-2-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl}-N,N-dimethylbenzenesulfonamide dihydrochloride
This compound is a crystalline solid with a molecular weight of approximately 539.78 g/mol. It is moderately soluble in water and ethanol. Chemically, it is reactive towards nucleophiles and electrophiles, and it can undergo various transformations such as substitution and condensation reactions. It is stable under normal conditions but requires storage in a cool, dry place away from direct sunlight.

About

English Name 3-{1-[(2Z)-4-Amino-2-fluoro-2-buten-1-yl]-2-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl}-N,N-dimethylbenzenesulfonamide dihydrochloride
Molecular Formula C20H25Cl2FN4O2S
Molecular Weight 475.42 g/mol
SMILES Cl.Cl.CN(C)S(=O)(=O)C1=CC(=CC=C1)C1C2=NC=CC=C2N(C/C(/F)=C/CN)C=1C
InChIKey INSNGJNTNAUITD-ULPVBNQHSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What industries use 3-{1-[(2Z)-4-Amino-2-fluoro-2-buten-1-yl]-2-methyl-1H-pyrrolo[3,2-b]pyridin-3-yl}-N,N-dimethylbenzenesulfonamide dihydrochloride (CAS: 2125956-82-1)?

This compound is primarily used in pharmaceutical applications due to its potential as a drug candid...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...