Compound Q&A

What are the physical and chemical properties of rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole (CAS: 147009-33-4)?

Answer

rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole
Rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole is a solid with a crystalline form. Its molecular weight is approximately 239.21 g/mol. The compound is sparingly soluble in polar solvents such as methanol and ethanol but insoluble in non-polar solvents. It is moderately reactive towards nucleophiles and can undergo substitution reactions. The compound is stable under normal conditions but should be stored at room temperature away from direct sunlight and moisture.

About

English Name rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole
Molecular Formula C14H15N3
Molecular Weight 225.29 g/mol
SMILES CNC1Cc2c(CC1)[nH]c1c2cc(cc1)C#N
InChIKey NDOGORNXJOIJOW-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole (CAS: 147009-33-4) typically synthesized?

Rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole can be synthesized by the condensation of 3-...

Compound Q&A

What industries use rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole (CAS: 147009-33-4)?

Rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole (CAS: 147009-33-4)?

When handling rac-6-Cyano-3-N-methylamino-1,2,3,4-tetrahydrocarbazole, wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...