Compound Q&A

What precautions should be taken when handling 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4)?

Answer

3-Acetoxy-4-cadinen-8-one
When handling 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be handled in a well-ventilated area, preferably within a fume hood, to avoid inhaling potentially harmful vapors. Spills should be cleaned up carefully, following the safety data sheet (SDS) guidelines, and the compound should be stored in a cool, dry place, away from any strong acids or bases to prevent unwanted reactions.

About

English Name 3-Acetoxy-4-cadinen-8-one
Molecular Formula C17H26O3
Molecular Weight 278.3865 g/mol
SMILES CC1CC(=O)C(C2C1CC(C(=C2)C)OC(=O)C)C(C)C
InChIKey BJLBGEPDNAWIIP-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4)?

3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) typically synthesized?

3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) is typically synthesized through a multi-step process i...

Compound Q&A

What industries use 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4)?

3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) is used in various industries, particularly in pharmace...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...