Compound Q&A

What are the physical and chemical properties of 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4)?

Answer

3-Acetoxy-4-cadinen-8-one
3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) is a crystalline solid with a molecular weight of approximately 268.36 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. This compound exhibits moderate reactivity, particularly towards nucleophilic substitution reactions. It is stable under normal storage conditions but should be kept away from strong bases and reducing agents to avoid unintended side reactions.

About

English Name 3-Acetoxy-4-cadinen-8-one
Molecular Formula C17H26O3
Molecular Weight 278.3865 g/mol
SMILES CC1CC(=O)C(C2C1CC(C(=C2)C)OC(=O)C)C(C)C
InChIKey BJLBGEPDNAWIIP-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) typically synthesized?

3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) is typically synthesized through a multi-step process i...

Compound Q&A

What industries use 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4)?

3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4) is used in various industries, particularly in pharmace...

Compound Q&A

What precautions should be taken when handling 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4)?

When handling 3-Acetoxy-4-cadinen-8-one (CAS: 923950-05-4), it is essential to wear appropriate pers...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...