Compound Q&A

What industries use Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9)?

Answer

Erythro-N-Boc-D-phenylalanine Epoxide
Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9) is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of chiral compounds and pharmaceuticals, particularly in the development of drugs targeting specific receptors. Additionally, it has applications in polymer chemistry for the preparation of functionalized polymers and in the development of sensors and semiconductors due to its unique reactivity.

About

CAS No 98818-34-9
English Name Erythro-N-Boc-D-phenylalanine Epoxide
Molecular Formula C15H21NO3
Molecular Weight 263.34 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C2CO2
InChIKey NVPOUMXZERMIJK-OLZOCXBDSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9)?

Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9) is a crystalline compound with a molecular w...

Compound Q&A

How is Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9) typically synthesized?

Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9) is synthesized via a Wittig reaction between...

Compound Q&A

What precautions should be taken when handling Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9)?

When handling Erythro-N-Boc-D-phenylalanine Epoxide (CAS: 98818-34-9), it is essential to wear prope...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...