Compound Q&A

What are the physical and chemical properties of Neolitsine (CAS: 2466-42-4)?

Answer

Neolitsine
Neolitsine (CAS: 2466-42-4) is a crystalline compound with a molecular weight of approximately 318.33 g/mol. It is sparingly soluble in water but soluble in organic solvents. Chemically, it is relatively stable but can react with strong oxidizing agents. Neolitsine has a melting point of 178-180°C and a boiling point of around 320°C under reduced pressure.

About

CAS No 2466-42-4
English Name Neolitsine
Molecular Formula C19H17NO4
Molecular Weight 323.3 g/mol
SMILES CN1CCC2=CC3=C(C4=C2C1CC5=CC6=C(C=C54)OCO6)OCO3
InChIKey GKEOKAJRKHTDOS-ZDUSSCGKSA-N
Last Updated: 2026-03-04 21:36

Related Q&A

Compound Q&A

How is Neolitsine (CAS: 2466-42-4) typically synthesized?

Neolitsine (CAS: 2466-42-4) is typically synthesized through a multi-step process involving the cond...

Compound Q&A

What industries use Neolitsine (CAS: 2466-42-4)?

Neolitsine (CAS: 2466-42-4) is primarily used in the pharmaceutical industry as an intermediate for ...

Compound Q&A

What precautions should be taken when handling Neolitsine (CAS: 2466-42-4)?

When handling Neolitsine (CAS: 2466-42-4), it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...