Compound Q&A

What are the physical and chemical properties of 1H,2H-Octafluorocyclopentane (CAS: 828-35-3)?

Answer

1H,2H-Octafluorocyclopentane
1H,2H-Octafluorocyclopentane (CAS: 828-35-3) is a colorless, odorless, and non-flammable liquid. It has a high vapor pressure and low solubility in water. The molecular weight is approximately 156.09 g/mol. It is relatively stable under normal conditions but can react with strong reducing agents. It is insoluble in water but miscible with organic solvents. It is used in the production of fluorocarbon compounds and as a solvent in certain applications.

About

CAS No 828-35-3
English Name 1H,2H-Octafluorocyclopentane
Molecular Formula C5H2F8
Molecular Weight 214.05 g/mol
SMILES C1(C(C(C(C1(F)F)(F)F)(F)F)F)F
InChIKey QVEJLBREDQLBKB-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

How is 1H,2H-Octafluorocyclopentane (CAS: 828-35-3) typically synthesized?

1H,2H-Octafluorocyclopentane (CAS: 828-35-3) can be synthesized through a fluoroalkylation process u...

Compound Q&A

What industries use 1H,2H-Octafluorocyclopentane (CAS: 828-35-3)?

1H,2H-Octafluorocyclopentane (CAS: 828-35-3) is primarily used in the chemical industry for the prod...

Compound Q&A

What precautions should be taken when handling 1H,2H-Octafluorocyclopentane (CAS: 828-35-3)?

When handling 1H,2H-Octafluorocyclopentane (CAS: 828-35-3), ensure proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...