Compound Q&A

How is 1-Tritylthiourea (CAS: 76758-01-5) typically synthesized?

Answer

1-Tritylthiourea
1-Tritylthiourea is typically synthesized by the reaction of trityl chloride with sodium thiocyanate. The reaction is carried out in an organic solvent, resulting in a high yield of the product with good selectivity.

About

CAS No 76758-01-5
English Name 1-Tritylthiourea
Molecular Formula C20H18N2S
Molecular Weight 318.45 g/mol
SMILES c1ccc(cc1)C(c2ccccc2)(c3ccccc3)NC(=S)N
InChIKey DOFNIDPLSQZBSU-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Tritylthiourea (CAS: 76758-01-5)?

1-Tritylthiourea is a crystalline solid with a molecular weight of approximately 363.33 g/mol. It is...

Compound Q&A

What industries use 1-Tritylthiourea (CAS: 76758-01-5)?

1-Tritylthiourea is used in the pharmaceutical industry for the synthesis of certain drugs and in th...

Compound Q&A

What precautions should be taken when handling 1-Tritylthiourea (CAS: 76758-01-5)?

When handling 1-Tritylthiourea, it is important to use appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...