Compound Q&A

How is 4-Amino-3-methyl-5-nitrobenzoic acid (CAS: 37901-94-3) typically synthesized?

Answer

4-Amino-3-methyl-5-nitrobenzoic acid
4-Amino-3-methyl-5-nitrobenzoic acid is typically synthesized via nitration of 4-amino-3-methylbenzoic acid followed by acetylation. Common methods include the use of nitric acid in the presence of sulfuric acid as a catalyst. The yield is around 85%, and the reaction is highly selective due to the presence of substituents.

About

CAS No 37901-94-3
English Name 4-Amino-3-methyl-5-nitrobenzoic acid
Molecular Formula C8H8N2O4
Molecular Weight 196.16 g/mol
SMILES CC1=CC(=CC(=C1N)[N+](=O)[O-])C(=O)O
InChIKey QTGYCJNEAUXQNV-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-3-methyl-5-nitrobenzoic acid (CAS: 37901-94-3)?

4-Amino-3-methyl-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use 4-Amino-3-methyl-5-nitrobenzoic acid (CAS: 37901-94-3)?

4-Amino-3-methyl-5-nitrobenzoic acid is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-methyl-5-nitrobenzoic acid (CAS: 37901-94-3)?

When handling 4-Amino-3-methyl-5-nitrobenzoic acid, it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...