Compound Q&A

How is (4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid (CAS: 105464-42-4) typically synthesized?

Answer

(4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid
(4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid is usually synthesized via a multi-step process involving protected amino acid synthesis. Commonly, the protected amino acid is made through the reaction of 5-hydroxypentanoic acid with tert-butoxycarbonyl chloride, followed by purification steps. This compound is often used in the synthesis of peptides and proteins.

About

English Name (4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid
Molecular Formula C10H19NO5
Molecular Weight 233.26 g/mol
SMILES CC(C)(C)OC(=O)N[C@H](CO)CCC(=O)O
InChIKey DCYLAKLDZHSCJV-ZETCQYMHSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid (CAS: 105464-42-4)?

The compound has a crystalline form and a molecular weight of approximately 212.27 g/mol. It is slig...

Compound Q&A

What industries use (4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid (CAS: 105464-42-4)?

(4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling (4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid (CAS: 105464-42-4)?

When handling (4S)-4-{[(tert-butoxy)carbonyl]amino}-5-hydroxypentanoic acid, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...