Compound Q&A

What industries use [4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid (CAS: 83590-77-6)?

Answer

[4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid
[4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid is used in the pharmaceutical industry for the synthesis of various drugs due to its acidic functional group. It is also employed in the polymer industry as a monomer for the preparation of functional polymers. Additionally, it finds applications in the sensor industry for the development of chemical sensors and as a precursor in semiconductor manufacturing for its acidic properties.

About

CAS No 83590-77-6
English Name [4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid
Molecular Formula C10H12O5
Molecular Weight 212.2 g/mol
SMILES COC1=C(C=CC(=C1)OCC(=O)O)CO
InChIKey ZKDXHLFLKKWCBY-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid (CAS: 83590-77-6)?

[4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid is a white crystalline solid with a molecular weight...

Compound Q&A

How is [4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid (CAS: 83590-77-6) typically synthesized?

[4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid is synthesized through a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling [4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid (CAS: 83590-77-6)?

When handling [4-(Hydroxymethyl)-3-methoxyphenoxy]acetic acid, it is important to use appropriate Pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...