Compound Q&A

How is 2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate (CAS: 91189-19-4) typically synthesized?

Answer

2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate
2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate is typically synthesized through a multi-step process involving the reactions of diphenylmethyl azide with 2-methyl-2-propanol followed by a carbamate formation step. The synthesis often requires the use of a catalyst and takes place in an organic solvent. The overall yield is moderate, and the process requires careful control of reaction conditions to achieve high selectivity and purity.

About

CAS No 91189-19-4
English Name 2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate
Molecular Formula C22H28N2O2
Molecular Weight 352.48 g/mol
SMILES CC(C)(C)OC(=O)NCC1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey UNMSZWOPUVNUIK-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate (CAS: 91189-19-4)?

2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate is a solid compound with a mo...

Compound Q&A

What industries use 2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate (CAS: 91189-19-4)?

2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate (CAS: 91189-19-4)?

When handling 2-Methyl-2-propanyl {[1-(diphenylmethyl)-3-azetidinyl]methyl}carbamate (CAS: 91189-19-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...