Compound Q&A

What are the main uses of 2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2)?

Answer

2-Aminophenyl beta-D-glucopyranosiduronic acid
The main uses of 2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2) include its application in chemical synthesis for the development of new compounds and in research for studying carbohydrate chemistry and molecular interactions. It may also have applications in pharmaceuticals for developing new drugs.

About

CAS No 15959-03-2
English Name 2-Aminophenyl beta-D-glucopyranosiduronic acid
Molecular Formula C12H15NO7
Molecular Weight 285.25 g/mol
SMILES C1=CC=C(C(=C1)N)OC2C(C(C(C(O2)C(=O)O)O)O)O
InChIKey ZVFVTBSWJWONEI-GOVZDWNOSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What is 2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2)?

2-Aminophenyl beta-D-glucopyranosiduronic acid is a chemical compound with the CAS number 15959-03-2...

Compound Q&A

Is 2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2) safe?

2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2) is generally considered safe for la...

Compound Q&A

How should 2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2) be stored?

2-Aminophenyl beta-D-glucopyranosiduronic acid (CAS: 15959-03-2) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...