Compound Q&A

What are the main uses of (2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine (CAS: 175591-22-7)?

Answer

(2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine
(2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine is primarily used in pharmaceutical research and development as a building block for synthesizing drug candidates. It also serves as a precursor in the synthesis of other complex organic compounds, which can have applications in various industries including chemical manufacturing, material science, and environmental chemistry.

About

English Name (2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine
Molecular Formula C15H25NO
Molecular Weight 235.37 g/mol
SMILES CC[C@@H](c1cccc(c1)OC)[C@@H](C)CN(C)C
InChIKey JKVBTSJLQLSTHJ-SWLSCSKDSA-N
Last Updated: 2026-03-04 03:05

Related Q&A

Compound Q&A

What is (2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine (CAS: 175591-22-7)?

(2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine is a chemical compound with the CAS number...

Compound Q&A

Is (2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine (CAS: 175591-22-7) safe?

(2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine is generally considered safe under normal ...

Compound Q&A

How should (2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine (CAS: 175591-22-7) be stored?

(2R,3R)-3-(3-Methoxyphenyl)-N,N,2-trimethyl-1-pentanamine should be stored in a cool, dry place away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...