Compound Q&A

What is 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone (CAS: 1159977-27-1)?

Answer

4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone
4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone (CAS: 1159977-27-1) is a derivative of the proton pump inhibitor rabeprazole, used in pharmaceutical applications. It is a sulfone compound and is less active than its parent compound, making it a useful intermediate in the synthesis of pharmaceuticals.

About

English Name 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone
Molecular Formula C14H12ClN3O2S
Molecular Weight 321.79 g/mol
SMILES CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)Cl
InChIKey ACKATQAAEKWYKV-UHFFFAOYSA-N
Last Updated: 2026-03-04 03:05

Related Q&A

Compound Q&A

What are the main uses of 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone (CAS: 1159977-27-1)?

The main uses of 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone include serving as an intermediat...

Compound Q&A

Is 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone (CAS: 1159977-27-1) safe?

4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone is generally considered safe when handled and stor...

Compound Q&A

How should 4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone (CAS: 1159977-27-1) be stored?

4-Desmethoxypropoxyl-4-chloro Rabeprazole Sulfone should be stored at a temperature between 15°C and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...