Compound Q&A

What are the main uses of 4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6)?

Answer

4-Fluoro-2-nitro-6-(trifluoromethyl)aniline
4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6) is primarily used as an intermediate in the synthesis of dyes and pharmaceuticals. It plays a crucial role in the development of new drugs and chemical reagents, contributing to both the pharmaceutical and dye manufacturing industries.

About

CAS No 344-29-6
English Name 4-Fluoro-2-nitro-6-(trifluoromethyl)aniline
Molecular Formula C7H4F4N2O2
Molecular Weight 224.11 g/mol
SMILES C1=C(C=C(C(=C1C(F)(F)F)N)[N+](=O)[O-])F
InChIKey XOQNQGVENLOUBD-UHFFFAOYSA-N
Last Updated: 2026-03-04 03:05

Related Q&A

Compound Q&A

What is 4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6)?

4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6) is an organic compound with a molecular ...

Compound Q&A

Is 4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6) safe?

4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6) is generally safe when handled with appr...

Compound Q&A

How should 4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6) be stored?

4-Fluoro-2-nitro-6-(trifluoromethyl)aniline (CAS: 344-29-6) should be stored in a cool, dry, and wel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...