Compound Q&A

Are there alternatives to 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6) in synthesis?

Answer

1-(1-Naphthyl)cyclopropanecarboxylic acid
Alternative reagents to 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6) in synthesis include other carboxylic acids with similar functional groups, such as 1-naphthoic acid or cyclopropanecarboxylic acids with different substituents. These alternatives can offer similar reactivity for various organic reactions, depending on the specific application and desired product.

About

English Name 1-(1-Naphthyl)cyclopropanecarboxylic acid
Molecular Formula C14H12O2
Molecular Weight 212.25 g/mol
SMILES C1CC1(C2=CC=CC3=CC=CC=C32)C(=O)O
InChIKey OUJODVKEBCXFEI-UHFFFAOYSA-N
Last Updated: 2026-03-03 01:43

Related Q&A

Compound Q&A

What regulatory guidelines apply to 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6)?

1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6) is subject to regulation under the Glob...

Compound Q&A

What is the market or research trend for 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6)?

The market for 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6) is largely driven by its...

Compound Q&A

How should waste containing 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6) be handled?

Waste containing 1-(1-Naphthyl)cyclopropanecarboxylic acid (CAS: 124276-38-6) should be collected in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...