Compound Q&A

What precautions should be taken when handling 1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid (CAS: 175136-93-3)?

Answer

1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid
When handling 1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid, it is essential to use proper personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. Work in a well-ventilated area or fume hood to avoid inhalation of vapors. Store the compound in a cool, dry place away from direct sunlight. In case of a spill, immediately clean up using appropriate methods and refer to the Safety Data Sheet (SDS) for detailed instructions.

About

English Name 1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid
Molecular Formula C10H11NO4
Molecular Weight 209.201 g/mol
SMILES C1C(CN(C1=O)CC2=CC=CO2)C(=O)O
InChIKey NFWHHUCJMAPGHE-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid (CAS: 175136-93-3)?

1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid is a white crystalline solid with a molecular w...

Compound Q&A

How is 1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid (CAS: 175136-93-3) typically synthesized?

1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid is typically synthesized via a multi-step proce...

Compound Q&A

What industries use 1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid (CAS: 175136-93-3)?

1-(2-Furylmethyl)-5-oxo-3-pyrrolidinecarboxylic acid is primarily used in the pharmaceutical industr...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...