Compound Q&A

What precautions should be taken when handling 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2)?

Answer

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid
When handling 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Proper spill cleanup procedures should be followed, and the Safety Data Sheet (SDS) should be readily accessible for reference.

About

CAS No 83747-30-2
English Name 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid
Molecular Formula C11H11NO3
Molecular Weight 205.21300000000002 g/mol
SMILES C1C2=CC=CC=C2C(=O)N1CCC(=O)O
InChIKey QMNYVASLMSOSFP-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2)?

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid is a white crystalline solid with a molecular w...

Compound Q&A

How is 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2) typically synthesized?

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid can be synthesized through the condensation of ...

Compound Q&A

What industries use 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2)?

This compound finds extensive use in pharmaceuticals for its bioactive properties, particularly in t...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...