Compound Q&A

What are the physical and chemical properties of 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2)?

Answer

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid
3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid is a white crystalline solid with a molecular weight of approximately 252.29 g/mol. It has a pKa of about 2.5 and is moderately soluble in water. Chemically, it is highly reactive towards nucleophiles and can undergo various transformations, such as esterification and amidation.

About

CAS No 83747-30-2
English Name 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid
Molecular Formula C11H11NO3
Molecular Weight 205.21300000000002 g/mol
SMILES C1C2=CC=CC=C2C(=O)N1CCC(=O)O
InChIKey QMNYVASLMSOSFP-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

How is 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2) typically synthesized?

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid can be synthesized through the condensation of ...

Compound Q&A

What industries use 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2)?

This compound finds extensive use in pharmaceuticals for its bioactive properties, particularly in t...

Compound Q&A

What precautions should be taken when handling 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid (CAS: 83747-30-2)?

When handling 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid, it is essential to wear appropri...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...