Compound Q&A

How is 1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9) typically synthesized?

Answer

1-(4-Phenoxyphenoxy)-2-propanol
1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9) is typically synthesized via a multistep organic synthesis, involving the preparation of an aryl halide followed by a nucleophilic substitution reaction with 2-bromopropane. The reaction is conducted under basic conditions, and the use of a phase transfer catalyst can enhance the yield and selectivity. The overall process is optimized for high purity and yield, making it suitable for industrial applications.

About

CAS No 57650-78-9
English Name 1-(4-Phenoxyphenoxy)-2-propanol
Molecular Formula C15H16O3
Molecular Weight 244.29 g/mol
SMILES CC(COC1=CC=C(C=C1)OC2=CC=CC=C2)O
InChIKey RVAHBQKJLFMRFE-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9)?

1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9) is a colorless to light yellow liquid with a molec...

Compound Q&A

What industries use 1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9)?

1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9)?

When handling 1-(4-Phenoxyphenoxy)-2-propanol (CAS: 57650-78-9), it is essential to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...