Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7)?

Answer

Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate
Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7) is a crystalline compound with a molecular weight of approximately 320.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is relatively stable but can react with strong bases. It exhibits good reactivity in nucleophilic substitution reactions.

About

CAS No 83279-66-7
English Name Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate
Molecular Formula C12H11Cl2N3O2
Molecular Weight 300.15 g/mol
SMILES CCOC(=O)C1=C(N(N=C1)C2=C(C=C(C=C2)Cl)Cl)N
InChIKey XOBRIYKLMQJCBQ-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

How is Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7) typically synthesized?

Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate is typically synthesized via a multi-...

Compound Q&A

What industries use Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7)?

Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7) is used in the phar...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7)?

When handling Ethyl 5-amino-1-(2,4-dichlorophenyl)-1H-pyrazole-4-carboxylate (CAS: 83279-66-7), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...