Compound Q&A

Are there alternatives to 2-Methyl-5-(thien-2-yl)-3-furoic acid in synthesis?

Answer

2-Methyl-5-(thien-2-yl)-3-furoic acid
In synthesis, there are several alternatives to 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2), such as analogous compounds like 2-Ethyl-5-(thien-2-yl)-3-furoic acid, or isomers like 2-Methyl-5-(thien-3-yl)-3-furoic acid. Common alternative reagents include 2-benzothiophene-3-carboxylic acid and 2-ethylthiophene-3-carboxylic acid, which can be used as starting materials or intermediates.

About

English Name 2-Methyl-5-(thien-2-yl)-3-furoic acid
Molecular Formula C10H8O3S
Molecular Weight 208.238 g/mol
SMILES CC1=C(C=C(O1)C2=CC=CS2)C(=O)O
InChIKey YXDCRSXNEOKXDE-UHFFFAOYSA-N
Last Updated: 2026-01-24 00:18

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2)?

The regulatory guidelines applicable to 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2) inc...

Compound Q&A

What is the market or research trend for 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2)?

The market and research trends for 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2) indicate...

Compound Q&A

How should waste containing 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2) be handled?

Waste containing 2-Methyl-5-(thien-2-yl)-3-furoic acid (CAS: 651005-90-2) should be handled with car...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A