Compound Q&A

How is 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate (CAS: 78-35-3) typically synthesized?

Answer

3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate
3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate can be synthesized via a condensation reaction between 3,7-dimethyl-1,6-octadien-3-ol and propanoyl chloride in the presence of a base such as sodium hydroxide. The reaction is typically carried out in an aprotic solvent like dimethylformamide (DMF) and proceeds with good selectivity and yield.

About

CAS No 78-35-3
English Name 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate
Molecular Formula C14H24O2
Molecular Weight 224.34 g/mol
SMILES CC(C)C(=O)OC(C)(CCC=C(C)C)C=C
InChIKey JZIARAQCPRDGAC-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate (CAS: 78-35-3)?

3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate is a colorless liquid with a molecular weight of a...

Compound Q&A

What industries use 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate (CAS: 78-35-3)?

3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate is used in the pharmaceutical industry as a precur...

Compound Q&A

What precautions should be taken when handling 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate (CAS: 78-35-3)?

When handling 3,7-Dimethyl-1,6-octadien-3-yl 2-methylpropanoate, it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...