Compound Q&A

What are the physical and chemical properties of 1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid (CAS: 1155847-27-0)?

Answer

1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid
1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid is a solid compound with a molecular weight of approximately 244.24 g/mol. It has a crystalline form and is slightly soluble in water. The compound is known for its reactivity in organic synthesis, particularly in esterification and amidation reactions.

About

English Name 1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid
Molecular Formula C8H7N3O2
Molecular Weight 177.16 g/mol
SMILES C1=CC2=C(NN=C2N=C1)CC(=O)O
InChIKey WHAQWKNPWBROHF-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is 1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid (CAS: 1155847-27-0) typically synthesized?

1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid is typically synthesized through the amidation of 1H-pyrazo...

Compound Q&A

What industries use 1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid (CAS: 1155847-27-0)?

1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid finds use in the pharmaceutical industry, where it serves a...

Compound Q&A

What precautions should be taken when handling 1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid (CAS: 1155847-27-0)?

When handling 1H-Pyrazolo[3,4-b]pyridine-3-acetic Acid, it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...