Compound Q&A

How is 4-Chlorobenzenesulfonyl isocyanate (CAS: 5769-15-3) typically synthesized?

Answer

4-Chlorobenzenesulfonyl isocyanate
4-Chlorobenzenesulfonyl isocyanate is typically synthesized via the reaction of 4-chlorobenzenesulfonyl chloride with phosgene. This process is conducted under anhydrous conditions using a suitable solvent such as toluene. The reaction is known to be highly effective and selective, yielding the target compound with a good yield.

About

CAS No 5769-15-3
English Name 4-Chlorobenzenesulfonyl isocyanate
Molecular Formula C7H4ClNO3S
Molecular Weight 217.63 g/mol
SMILES C1=CC(=CC=C1S(=O)(=O)N=C=O)Cl
InChIKey JGHDVROWMPBQSR-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chlorobenzenesulfonyl isocyanate (CAS: 5769-15-3)?

4-Chlorobenzenesulfonyl isocyanate is a white crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use 4-Chlorobenzenesulfonyl isocyanate (CAS: 5769-15-3)?

4-Chlorobenzenesulfonyl isocyanate finds applications in pharmaceuticals, where it is used as a prec...

Compound Q&A

What precautions should be taken when handling 4-Chlorobenzenesulfonyl isocyanate (CAS: 5769-15-3)?

When handling 4-Chlorobenzenesulfonyl isocyanate, safety measures should include the use of personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...