Compound Q&A

What are the physical and chemical properties of (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate (CAS: 419563-22-7)?

Answer

(1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate
The compound (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate is a white crystalline solid with a molecular weight of approximately 220.32 g/mol. It is soluble in water and ethanol. Chemically, it is a reactive compound due to the presence of a carboxylic acid and amino functionalities. It readily forms salts and esters, and is sensitive to basic conditions.

About

English Name (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate
Molecular Formula C11H17NO8
Molecular Weight 291.25 g/mol
SMILES COC(=O)C1CC(C=C1)N.C(C(C(=O)O)O)(C(=O)O)O
InChIKey XSEHIOOHMZAFCV-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate (CAS: 419563-22-7) typically synthesized?

The compound can be synthesized through a condensation reaction involving (1S)-4-amino-2-cyclopenten...

Compound Q&A

What industries use (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate (CAS: 419563-22-7)?

The compound is primarily used in the pharmaceutical industry for the synthesis of various drugs and...

Compound Q&A

What precautions should be taken when handling (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate (CAS: 419563-22-7)?

When handling (1S,4R)-4-Amino-2-cyclopentene-1-carboxylic Acid Methyl Ester L-Tartrate, it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...