Compound Q&A

What are the physical and chemical properties of 2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid (CAS: 69956-77-0)?

Answer

2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid
2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid has a crystalline form with a molecular weight of approximately 310.45 g/mol. It has a limited solubility in water and a higher solubility in organic solvents like ethanol and acetone. The compound is relatively stable under normal conditions but can undergo hydrolysis in strongly acidic or basic media. It is reactive towards nucleophiles and can participate in condensation reactions.

About

CAS No 69956-77-0
English Name 2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid
Molecular Formula C16H18O3
Molecular Weight 258.32 g/mol
SMILES CC(C1=CC=C(C=C1)C=C2CCCCC2=O)C(=O)O
InChIKey AUZUGWXLBGZUPP-GXDHUFHOSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is 2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid (CAS: 69956-77-0) typically synthesized?

2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid is synthesized via a multi-step process...

Compound Q&A

What industries use 2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid (CAS: 69956-77-0)?

2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid is utilized in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid (CAS: 69956-77-0)?

When handling 2-{4-[(E)-(2-Oxocyclohexylidene)methyl]phenyl}propanoic acid, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...