Compound Q&A

What industries use {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5)?

Answer

{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid
{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid is primarily used in the pharmaceutical and polymer industries for the synthesis of drug molecules and functional polymers. It also finds applications in the semiconductor industry for the production of boron-doped materials and in the development of advanced sensors. Its versatile reactivity and specific functional groups make it a valuable compound in these sectors.

About

English Name {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid
Molecular Formula C13H18BNO3
Molecular Weight 247.10300000000004 g/mol
SMILES CC1CCN(CC1)C(=O)c1cccc(c1)B(O)O
InChIKey KDLCYMDXPOEVCG-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5)?

{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid is a white crystalline solid with a molecul...

Compound Q&A

How is {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5) typically synthesized?

{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid can be synthesized through a multistep proc...

Compound Q&A

What precautions should be taken when handling {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5)?

When handling {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid, it is essential to wear appr...

Compound Q&A

Is Sodium Acrylate (CAS: 7446-81-3) safe?

Sodium acrylate (CAS: 7446-81-3) is generally recognized as safe (GRAS) by the F...

7446-81-3Sodium acrylate
Compound Q&A

What are the physical and chemical properties of Boc-N-PEG2-Ms (CAS: 302331-20-0)?

Boc-N-PEG2-Ms is a bifunctional polyethylene glycol derivative with a molecular ...

302331-20-0Boc-N-PEG2-Ms
Compound Q&A

What regulatory guidelines apply to 2-[3-(4-Methylbenzoyl)phenyl]propanoic acid (CAS: 107257-20-5)?

2-[3-(4-Methylbenzoyl)phenyl]propanoic acid (CAS: 107257-20-5) should comply wit...

107257-20-52-[3-(4-Methylbenzoy...
Compound Q&A

How should 1H-Pyrazolo[3,4-b]pyridine-3-carbaldehyde (CAS: 1010073-87-6) be stored?

1H-Pyrazolo[3,4-b]pyridine-3-carbaldehyde should be stored in a cool, dry place ...

1010073-87-61H-Pyrazolo[3,4-b]py...