Compound Q&A

What are the physical and chemical properties of {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5)?

Answer

{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid
{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid is a white crystalline solid with a molecular weight of approximately 345.36 g/mol. It has limited solubility in water but is soluble in organic solvents like methanol and ethanol. It is known for its reactivity in organoboron coupling reactions and is used in the synthesis of various boron-containing compounds. Its purity is critical for its use in organic synthesis, and it should be stored in a dry environment to prevent degradation.

About

English Name {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid
Molecular Formula C13H18BNO3
Molecular Weight 247.10300000000004 g/mol
SMILES CC1CCN(CC1)C(=O)c1cccc(c1)B(O)O
InChIKey KDLCYMDXPOEVCG-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5) typically synthesized?

{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid can be synthesized through a multistep proc...

Compound Q&A

What industries use {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5)?

{3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid (CAS: 850567-30-5)?

When handling {3-[(4-Methyl-1-piperidinyl)carbonyl]phenyl}boronic acid, it is essential to wear appr...

Compound Q&A

Is Sodium Acrylate (CAS: 7446-81-3) safe?

Sodium acrylate (CAS: 7446-81-3) is generally recognized as safe (GRAS) by the F...

7446-81-3Sodium acrylate
Compound Q&A

What are the physical and chemical properties of Boc-N-PEG2-Ms (CAS: 302331-20-0)?

Boc-N-PEG2-Ms is a bifunctional polyethylene glycol derivative with a molecular ...

302331-20-0Boc-N-PEG2-Ms
Compound Q&A

What regulatory guidelines apply to 2-[3-(4-Methylbenzoyl)phenyl]propanoic acid (CAS: 107257-20-5)?

2-[3-(4-Methylbenzoyl)phenyl]propanoic acid (CAS: 107257-20-5) should comply wit...

107257-20-52-[3-(4-Methylbenzoy...
Compound Q&A

How should 1H-Pyrazolo[3,4-b]pyridine-3-carbaldehyde (CAS: 1010073-87-6) be stored?

1H-Pyrazolo[3,4-b]pyridine-3-carbaldehyde should be stored in a cool, dry place ...

1010073-87-61H-Pyrazolo[3,4-b]py...