Compound Q&A

What precautions should be taken when handling Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4)?

Answer

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate
When handling Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. In case of spills, immediately contain the spill using appropriate absorbents and dispose of the material according to the Material Safety Data Sheet (MSDS/SDS).

About

English Name Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate
Molecular Formula C9H7BrO2S2
Molecular Weight 291.19100000000003 g/mol
SMILES CCOC(=O)C1=C(Br)SC2C=CSC=21
InChIKey TUHICDLJBHTOJQ-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4)?

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) is a solid compound with a mol...

Compound Q&A

How is Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) typically synthesized?

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) is typically synthesized throu...

Compound Q&A

What industries use Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4)?

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) is used in various industries,...

Compound Q&A

What is 2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0)?

2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0) is a benzoic acid derivativ...

16611-84-02-Hydroxy-6-pentadec...
Compound Q&A

What are the main uses of 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4) is primarily use...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)?

1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)...

105637-50-11-[(5-Chloro-1-napht...
Compound Q&A

What regulatory guidelines apply to 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6)?

1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6) is regulated u...

28523-86-61,1,1,3,3,3-Hexafluo...