Compound Q&A

What are the physical and chemical properties of Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4)?

Answer

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate
Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) is a solid compound with a molecular weight of approximately 332.07 g/mol. It has a high melting point and is poorly soluble in water but soluble in common organic solvents such as dichloromethane and ethyl acetate. Chemically, it is relatively stable but can react with strong nucleophiles. It exhibits weak acidity due to the carboxylic acid group.

About

English Name Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate
Molecular Formula C9H7BrO2S2
Molecular Weight 291.19100000000003 g/mol
SMILES CCOC(=O)C1=C(Br)SC2C=CSC=21
InChIKey TUHICDLJBHTOJQ-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:36

Related Q&A

Compound Q&A

How is Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) typically synthesized?

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) is typically synthesized throu...

Compound Q&A

What industries use Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4)?

Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4) is used in various industries,...

Compound Q&A

What precautions should be taken when handling Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4)?

When handling Ethyl 2-bromothieno[3,2-b]thiophene-3-carboxylate (CAS: 2055722-78-4), it is essential...

Compound Q&A

What is 2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0)?

2-Hydroxy-6-pentadecylbenzoic acid (CAS: 16611-84-0) is a benzoic acid derivativ...

16611-84-02-Hydroxy-6-pentadec...
Compound Q&A

What are the main uses of 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4) is primarily use...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)?

1-[(5-Chloro-1-naphthyl)sulfonyl]-1,4-diazepane hydrochloride (CAS: 105637-50-1)...

105637-50-11-[(5-Chloro-1-napht...
Compound Q&A

What regulatory guidelines apply to 1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6)?

1,1,1,3,3,3-Hexafluoro-2-(fluoromethoxy)propane (CAS: 28523-86-6) is regulated u...

28523-86-61,1,1,3,3,3-Hexafluo...