Compound Q&A

What are the physical and chemical properties of Alpha-bromo-3'-acetoxyacetophenone (CAS: 38396-89-3)?

Answer

Alpha-bromo-3'-acetoxyacetophenone
Alpha-bromo-3'-acetoxyacetophenone is a colorless to white crystalline solid with a molecular weight of approximately 291.07 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is highly reactive due to the presence of the bromine and acetoxy groups, displaying typical electrophilic properties. It is often used in organic synthesis and as a reagent in chemical reactions.

About

CAS No 38396-89-3
English Name Alpha-bromo-3'-acetoxyacetophenone
Molecular Formula C10H9BrO3
Molecular Weight 257.08 g/mol
SMILES CC(=O)OC1=CC=CC(=C1)C(=O)CBr
InChIKey YLJZSPJKMBFLRA-UHFFFAOYSA-N
Last Updated: 2026-01-13 10:35

Related Q&A

Compound Q&A

How is Alpha-bromo-3'-acetoxyacetophenone (CAS: 38396-89-3) typically synthesized?

Alpha-bromo-3'-acetoxyacetophenone is commonly synthesized through the bromination of 3'-acetoxyacet...

Compound Q&A

What industries use Alpha-bromo-3'-acetoxyacetophenone (CAS: 38396-89-3)?

Alpha-bromo-3'-acetoxyacetophenone is primarily used in the pharmaceutical and polymer industries. I...

Compound Q&A

What precautions should be taken when handling Alpha-bromo-3'-acetoxyacetophenone (CAS: 38396-89-3)?

When handling Alpha-bromo-3'-acetoxyacetophenone, it is crucial to use proper personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...