Compound Q&A

How is [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7) typically synthesized?

Answer

[2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid
The synthesis of [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7) typically involves a multi-step process starting with 2-chloro-6-(trifluoromethyl)-4-pyridine, which is converted to the boronic acid via a boronation reaction using an appropriate boronate ester and a catalyst like Pd(PPh3)4. The reaction yields a product with high purity and good selectivity.

About

English Name [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid
Molecular Formula C6H4BClF3NO2
Molecular Weight 225.36199999999997 g/mol
SMILES OB(O)c1cc(Cl)nc(c1)C(F)(F)F
InChIKey LVJRNQWDVNYDOI-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7)?

The compound [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7) is a crystal...

Compound Q&A

What industries use [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7)?

This compound is used in various industries, particularly in pharmaceuticals for the synthesis of co...

Compound Q&A

What precautions should be taken when handling [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7)?

When handling [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7), it is esse...

Compound Q&A

What is 1-(2,4,6-Trifluorophenyl)ethanol (CAS: 1250113-83-7)?

1-(2,4,6-Trifluorophenyl)ethanol is an organic compound with the CAS number 1250...

1250113-83-71-(2,4,6-Trifluoroph...
Compound Q&A

Is 1-(2,4-Dimethoxybenzyl)-4-(hydroxymethyl)-2-pyrrolidinone (CAS: 919111-34-5) safe?

1-(2,4-Dimethoxybenzyl)-4-(hydroxymethyl)-2-pyrrolidinone (CAS: 919111-34-5) is ...

919111-34-51-(2,4-Dimethoxybenz...
Compound Q&A

What are the physical and chemical properties of (7S,15R)-6β,15-Diacetoxy-7α,20-epoxy-7-hydroxykaura-2,16-dien-1-one (CAS: 51419-51-3)?

(7S,15R)-6β,15-Diacetoxy-7α,20-epoxy-7-hydroxykaura-2,16-dien-1-one is a crystal...

51419-51-3(7S,15R)-6β,15-Diace...
Compound Q&A

What regulatory guidelines apply to rac-ethyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans (CAS: 3618-04-0)?

The compound rac-ethyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans (CAS: 3...

3618-04-0rac-ethyl (1r,4r)-4-...