Compound Q&A

What are the physical and chemical properties of [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7)?

Answer

[2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid
The compound [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7) is a crystalline solid with a molecular weight of approximately 345.03 g/mol. It has limited solubility in water and is more soluble in organic solvents. Chemically, it is moderately reactive, especially towards nucleophiles. It is used in various chemical reactions due to its stability and reactivity.

About

English Name [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid
Molecular Formula C6H4BClF3NO2
Molecular Weight 225.36199999999997 g/mol
SMILES OB(O)c1cc(Cl)nc(c1)C(F)(F)F
InChIKey LVJRNQWDVNYDOI-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

How is [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7) typically synthesized?

The synthesis of [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7) typicall...

Compound Q&A

What industries use [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7)?

This compound is used in various industries, particularly in pharmaceuticals for the synthesis of co...

Compound Q&A

What precautions should be taken when handling [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7)?

When handling [2-Chloro-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS: 1446486-10-7), it is esse...

Compound Q&A

What is 1-(2,4,6-Trifluorophenyl)ethanol (CAS: 1250113-83-7)?

1-(2,4,6-Trifluorophenyl)ethanol is an organic compound with the CAS number 1250...

1250113-83-71-(2,4,6-Trifluoroph...
Compound Q&A

Is 1-(2,4-Dimethoxybenzyl)-4-(hydroxymethyl)-2-pyrrolidinone (CAS: 919111-34-5) safe?

1-(2,4-Dimethoxybenzyl)-4-(hydroxymethyl)-2-pyrrolidinone (CAS: 919111-34-5) is ...

919111-34-51-(2,4-Dimethoxybenz...
Compound Q&A

What are the physical and chemical properties of (7S,15R)-6β,15-Diacetoxy-7α,20-epoxy-7-hydroxykaura-2,16-dien-1-one (CAS: 51419-51-3)?

(7S,15R)-6β,15-Diacetoxy-7α,20-epoxy-7-hydroxykaura-2,16-dien-1-one is a crystal...

51419-51-3(7S,15R)-6β,15-Diace...
Compound Q&A

What regulatory guidelines apply to rac-ethyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans (CAS: 3618-04-0)?

The compound rac-ethyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans (CAS: 3...

3618-04-0rac-ethyl (1r,4r)-4-...