Compound Q&A

What industries use (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1) (CAS: 51-40-1)?

Answer

(2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1)
The compound (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1) (CAS: 51-40-1) is primarily used in the pharmaceutical industry for the synthesis of chiral intermediates and drug candidates. It also has applications in the polymer industry, where it can serve as a monomer or crosslinking agent. Additionally, it can be used in the development of sensors and as a precursor in semiconductor manufacturing due to its unique chemical properties.

About

CAS No 51-40-1
English Name (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1)
Molecular Formula C12H17NO9
Molecular Weight 319.27 g/mol
SMILES C1=CC(=C(C=C1C(CN)O)O)O.C(C(C(=O)O)O)(C(=O)O)O
InChIKey WNPNNLQNNJQYFA-YIDNRZKSSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1) (CAS: 51-40-1)?

The compound (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1...

Compound Q&A

How is (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1) (CAS: 51-40-1) typically synthesized?

The compound (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1...

Compound Q&A

What precautions should be taken when handling (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (1:1) (CAS: 51-40-1)?

When handling (2R,3R)-2,3-Dihydroxysuccinic acid - 4-[(1R)-2-amino-1-hydroxyethyl]-1,2-benzenediol (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...