Compound Q&A

What is Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8)?

Answer

Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (1:1)
Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8) is a chemical compound used in pharmaceutical research and development. It is a derivative of piperidine and benzylamine, forming a hydrochloride salt to enhance its stability.

About

English Name Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (1:1)
Molecular Formula C20H25ClN2O2
Molecular Weight 360.88 g/mol
SMILES c1ccc(cc1)CNC2CCCN(C2)C(=O)OCc3ccccc3.Cl
InChIKey HDRCYKKARRFRJF-UHFFFAOYSA-N
Last Updated: 2026-01-13 01:56

Related Q&A

Compound Q&A

What are the main uses of Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8)?

Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8) is primarily used i...

Compound Q&A

Is Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8) safe?

Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8) is generally safe w...

Compound Q&A

How should Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8) be stored?

Benzyl 3-(benzylamino)-1-piperidinecarboxylate hydrochloride (CAS: 1179362-03-8) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...