Compound Q&A

What is 2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 1206550-99-3)?

Answer

2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid is a chemical compound with the CAS number 1206550-99-3. It is a thiazole derivative with a carboxylic acid functional group, and it is characterized by its aromatic and aliphatic substituents. This compound is often used in the synthesis of other organic compounds and pharmaceuticals due to its unique structure.

About

English Name 2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
Molecular Formula C15H17NO3S
Molecular Weight 291.37 g/mol
SMILES Cc1c(sc(n1)c2ccc(cc2)OCC(C)C)C(=O)O
InChIKey ZDKJCYASUIQELO-UHFFFAOYSA-N
Last Updated: 2026-01-13 01:56

Related Q&A

Compound Q&A

What are the main uses of 2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 1206550-99-3)?

2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid is primarily used in the pharmaceutica...

Compound Q&A

Is 2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 1206550-99-3) safe?

2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid is generally considered safe for labor...

Compound Q&A

How should 2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS: 1206550-99-3) be stored?

2-(4-Isobutoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid should be stored in a cool, dry place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...