Compound Q&A

Is 1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene (CAS: 677275-33-1) safe?

Answer

1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene
1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene is generally considered safe for laboratory use when proper safety measures are followed. However, it should be handled with care due to its potential for skin and eye irritation. Protective gloves and goggles are recommended.

About

English Name 1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene
Molecular Formula C36H44
Molecular Weight 476.75 g/mol
SMILES CC(C)(C)C1=C2C=CC(=C3C2=C(C=C1)C4=C(C=CC5=C(C=CC3=C54)C(C)(C)C)C(C)(C)C)C(C)(C)C
InChIKey UUGBGJGAHVLTRN-UHFFFAOYSA-N
Last Updated: 2026-01-13 01:56

Related Q&A

Compound Q&A

What is 1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene (CAS: 677275-33-1)?

1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene is a derivative of perylene, characterized by a uniqu...

Compound Q&A

What are the main uses of 1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene (CAS: 677275-33-1)?

1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene is primarily used in the development of organic light...

Compound Q&A

How should 1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene (CAS: 677275-33-1) be stored?

1,4,7,10-Tetrakis(2-methyl-2-propanyl)perylene should be stored in a cool, dry place away from direc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...