Compound Q&A

What is 1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0)?

Answer

1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine
1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine is an organic compound with the CAS number 211247-62-0. It is an amine derivative with a piperidine ring and a phenyl group containing an amino group. This compound is known for its specific chemical properties and potential applications in pharmaceuticals and research.

About

English Name 1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine
Molecular Formula C13H21N3
Molecular Weight 219.33 g/mol
SMILES CN(C)C1CCN(CC1)c2ccc(N)cc2
InChIKey PFDUBQQHEHJNQX-UHFFFAOYSA-N
Last Updated: 2026-01-09 18:46

Related Q&A

Compound Q&A

What are the main uses of 1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0)?

1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0) is primarily used in pharmaceutic...

Compound Q&A

Is 1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0) safe?

1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0) is generally considered safe when...

Compound Q&A

How should 1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0) be stored?

1-(4-Aminophenyl)-N,N-dimethyl-4-piperidinamine (CAS: 211247-62-0) should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...