Compound Q&A

How should 4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4) be stored?

Answer

4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline
4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4) should be stored in a cool, dry place away from direct sunlight and sources of ignition. It should be kept in a well-ventilated area and stored in a tightly sealed container to prevent degradation and contamination. The temperature should be maintained between 0-25°C to ensure proper storage conditions.

About

English Name 4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline
Molecular Formula C9H10BrFN2O2
Molecular Weight 277.0903 g/mol
SMILES CC(C)NC1=CC(=C(C=C1[N+](=O)[O-])Br)F
InChIKey BPXMIORTUXUUGS-UHFFFAOYSA-N
Last Updated: 2026-01-09 18:46

Related Q&A

Compound Q&A

What is 4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4)?

4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4) is a complex aromatic organic compou...

Compound Q&A

What are the main uses of 4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4)?

4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4) is predominantly used in the pharmac...

Compound Q&A

Is 4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4) safe?

4-Bromo-5-fluoro-N-isopropyl-2-nitroaniline (CAS: 1314987-28-4) is generally safe when handled with ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...