Compound Q&A

How should 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 284493-57-8) be stored?

Answer

3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Avoid storing it near incompatible materials such as acids or strong bases. Store at a temperature below 25°C and maintain a relative humidity below 50% to ensure stability and safety.

About

English Name 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
Molecular Formula C15H21NO4
Molecular Weight 279.33 g/mol
SMILES CC1=CC(=CC=C1)C(CC(=O)O)NC(=O)OC(C)(C)C
InChIKey XICHKLMIOJEDAM-UHFFFAOYSA-N
Last Updated: 2026-01-09 14:49

Related Q&A

Compound Q&A

What is 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 284493-57-8)?

3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is a chemical compoun...

Compound Q&A

What are the main uses of 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 284493-57-8)?

3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is primarily used in ...

Compound Q&A

Is 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 284493-57-8) safe?

3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid is generally safe whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...