Compound Q&A

What are the main uses of Triphenyl(4-pyridinylmethyl)phosphonium chloride (CAS: 73870-25-4)?

Answer

Triphenyl(4-pyridinylmethyl)phosphonium chloride
Triphenyl(4-pyridinylmethyl)phosphonium chloride is primarily used in pharmaceuticals, specifically as an intermediate in the synthesis of other compounds. It is also utilized in research for its unique chemical properties, and can be found in some industrial applications where its specific chemical structure is beneficial.

About

CAS No 73870-25-4
English Name Triphenyl(4-pyridinylmethyl)phosphonium chloride
Molecular Formula C24H21ClNP
Molecular Weight 389.86 g/mol
SMILES C1=CC=C(C=C1)[P+](CC2=CC=NC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
InChIKey UGDYRTOUNGDPDN-UHFFFAOYSA-M
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is Triphenyl(4-pyridinylmethyl)phosphonium chloride (CAS: 73870-25-4)?

Triphenyl(4-pyridinylmethyl)phosphonium chloride is a chemical compound with the CAS number 73870-25...

Compound Q&A

Is Triphenyl(4-pyridinylmethyl)phosphonium chloride (CAS: 73870-25-4) safe?

Triphenyl(4-pyridinylmethyl)phosphonium chloride is generally considered safe when used and handled ...

Compound Q&A

How should Triphenyl(4-pyridinylmethyl)phosphonium chloride (CAS: 73870-25-4) be stored?

Triphenyl(4-pyridinylmethyl)phosphonium chloride should be stored in a cool, dry place, away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...