Compound Q&A

What are the main uses of 6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid (CAS: 1159827-21-0)?

Answer

6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid
6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid is primarily used in the field of medicinal chemistry and drug discovery. It serves as a starting material for the synthesis of bioactive compounds, particularly those targeting specific biological pathways and receptors. This compound is also of interest in materials science due to its potential use in developing new materials with unique properties.

About

English Name 6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES Brc1ccc2n(c1)c(nc2)C(=O)O
InChIKey KXXPDFVCPKKRAZ-UHFFFAOYSA-N
Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What is 6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid (CAS: 1159827-21-0)?

6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid is an organic compound with the CAS number 1159827-2...

Compound Q&A

Is 6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid (CAS: 1159827-21-0) safe?

6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid is considered safe for laboratory use when handled w...

Compound Q&A

How should 6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid (CAS: 1159827-21-0) be stored?

6-Bromoimidazo[1,5-a]pyridine-3-carboxylic acid should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...